| Name | N,N-Diethylformamide |
| Synonyms | N,N-DiethyL DIETHYL FORMAMIDE FORMYLDIETHYLAMINE N,N-DIETHYLFORMAMIDE N,N-Diethylformamide N-Formyldiethylamine n,n-diethyl-formamid N,N-DIETHYLFORMYLAMIDE N,N-Diethylformylamide FORMIC ACID DIETHYLAMIDE |
| CAS | 617-84-5 |
| EINECS | 210-533-2 |
| InChI | InChI=1/C5H11NO/c1-3-6(4-2)5-7/h5H,3-4H2,1-2H3 |
| InChIKey | SUAKHGWARZSWIH-UHFFFAOYSA-N |
| Molecular Formula | C5H11NO |
| Molar Mass | 101.15 |
| Density | 0.908 g/mL at 25 °C (lit.) |
| Melting Point | 176-177°C |
| Boling Point | 176-177 °C (lit.) |
| Flash Point | 141°F |
| Solubility | Miscible with acetone, benzene, alcohol and ether. |
| Vapor Presure | 1.04mmHg at 25°C |
| Appearance | Transparent liquid |
| Color | Clear colorless to pale yellow |
| BRN | 1209392 |
| pKa | -0.44±0.70(Predicted) |
| Storage Condition | Store below +30°C. |
| Sensitive | Sensitive to light |
| Refractive Index | n20/D 1.434(lit.) |
| MDL | MFCD00003287 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S37/39 - Wear suitable gloves and eye/face protection |
| UN IDs | UN 1993 3/PG 3 |
| WGK Germany | 1 |
| RTECS | LQ1925000 |
| TSCA | Yes |
| HS Code | 29241990 |
| Hazard Class | 3 |
| Packing Group | III |
| Reference Show more | 1. [IF=6.331] Xiao Liang et al."Urate oxidase loaded in PCN-222(Fe) with peroxidase-like activity for colorimetric detection of uric acid."J Mater Chem B. 2021 Sep;9(34):6811-6817 |
| EPA chemical substance information | information provided by: ofmpeb.epa.gov (external link) |
| category | combustible articles |
| toxicity grade | poisoning |
| Acute toxicity | intraperitoneal-rat LD50: 1740 mg/kg; Intraperitoneal-mouse LD50: 3200 mg/kg |
| flammability hazard characteristics | flammable in open flame, high temperature, strong oxidant; combustion emission toxic nitrogen oxide smoke |
| storage and transportation characteristics | The package is complete, light and light unloading; The warehouse is ventilated, away from open flame, high temperature, and oxidant, separate storage of acid |
| fire extinguishing agent | foam, dry powder, carbon dioxide, water mist, sand |